CAS 704-41-6
:2-Ethynyl-alpha,alpha,alpha-trifluorotoluene
Description:
2-Ethynyl-alpha,alpha,alpha-trifluorotoluene, with the CAS number 704-41-6, is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and an ethynyl group attached to a toluene backbone. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its low solubility in water but is soluble in organic solvents, making it useful in various chemical applications. The presence of trifluoromethyl groups imparts notable chemical stability and influences its reactivity, often making it a subject of interest in synthetic organic chemistry and materials science. Additionally, due to its ethynyl functional group, it can participate in various coupling reactions, making it valuable in the synthesis of more complex molecules. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-Ethynyl-alpha,alpha,alpha-trifluorotoluene is a versatile compound with applications in research and industry.
Formula:C9H5F3
InChI:InChI=1/C9H5F3/c10-9(11,12)7-6-8-4-2-1-3-5-8/h1-5H
SMILES:c1ccc(cc1)C#CC(F)(F)F
Synonyms:- 2-(Trifluoromethyl)phenylacetylene
- 1-Ethynyl-2-(Trifluoromethyl)Benzene
- (3,3,3-Trifluoroprop-1-Yn-1-Yl)Benzene
- 2-Ethynyltrifluorotoluene
- 1-Ethynyl-2-trifluoromethylbenzene
- 2'-Trifluoromethylphenyl acetylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Trifluoromethyl)phenylacetylene, 97%
CAS:<p>2-(Trifluoromethyl)phenylacetylene is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SK</p>Formula:C9H5F3Purity:97%Molecular weight:170.132-(Trifluoromethyl)phenylacetylene
CAS:<p>2-(Trifluoromethyl)phenylacetylene</p>Purity:98%Color and Shape:Colourless LiquidMolecular weight:170.13g/mol2′-Trifluoromethylphenyl acetylene
CAS:Formula:C9H5F3Purity:97%Color and Shape:LiquidMolecular weight:170.134


