CAS 704-45-0

2-methoxy-4-methylbenzoic acid

Description:

2-Methoxy-4-methylbenzoic acid, also known as o-anisic acid, is an aromatic carboxylic acid characterized by a methoxy group and a methyl group attached to a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 2-position with a methoxy group (-OCH3) and at the 4-position with a methyl group (-CH3), contributing to its unique chemical properties. This compound is typically a white to off-white crystalline solid with moderate solubility in organic solvents and limited solubility in water. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 2-methoxy-4-methylbenzoic acid can serve as an intermediate in organic synthesis and may have applications in pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by the presence of the methoxy and methyl substituents, which can affect its electronic properties and steric hindrance.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)8(5-6)12-2/h3-5H,1-2H3,(H,10,11)

SMILES: Cc1ccc(c(c1)OC)C(=O)O

Synonyms:

• Benzoic acid,2-methoxy-4-methyl-

4-Methyl-2-methoxybenzoic acid

CAS: 704-45-0

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA003B8T

2-Methoxy-4-methylbenzoic acid

CAS: 704-45-0

2-Methoxy-4-methylbenzoic acid

Purity: 97%

Molecular weight: 166.17g/mol

Ref: 54-OR400236

2-Methoxy-4-methylbenzoic acid

CAS: 704-45-0

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F022645