CAS 70401-32-0
:2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide
Description:
2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide is a chemical compound characterized by its complex bicyclic structure, which includes a dibenzazepine framework. This compound features a carboxamide functional group, contributing to its potential as a pharmacologically active agent. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the methyl group at the 2-position of the azepine ring can influence its biological activity and interaction with various receptors. This compound is of interest in medicinal chemistry, particularly for its potential applications in treating neurological disorders or as an antipsychotic agent. Its molecular structure allows for various interactions with biological targets, making it a subject of research in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide represents a significant compound in the study of heterocyclic chemistry and pharmacology.
Formula:C16H14N2O
InChI:InChI=1S/C16H14N2O/c1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)18(15)16(17)19/h2-10H,1H3,(H2,17,19)
InChI key:InChIKey=WLUGVRXHDCWYLA-UHFFFAOYSA-N
SMILES:C(N)(=O)N1C=2C(C=CC=3C1=CC=CC3)=CC(C)=CC2
Synonyms:- 2-methyl-5H-dibenzo[b,f]azepine-5-carboxamide
- 5H-Dibenz[b,f]azepine-5-carboxamide, 2-methyl-
- 2-Methyl-5H-dibenz(b,f)azepine-5-carboxamide
- 2-Methyl-5H-dibenz[b,f]azepine-5-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Methyl Carbamazepine
CAS:Controlled Product<p>Applications A new internal standard for chromatographic assays of Carbamazepine (C175840) (Tegretol).<br>References Allais, A., et al.: Eur. J. Med. Chem., 17, 371 (1982), Eichenberger, E., et al.: Arzneim.-Forsch., 34, 110 (1984), Learmonth, D., et al.: Eur. J. Med. Chem., 36, 227 (2001),<br></p>Formula:C16H14N2OColor and Shape:NeatMolecular weight:250.30

