CAS 70402-10-7

6-hydroxy-4H-furo[3,2-c]pyran-2(6H)-one

Description:

6-Hydroxy-4H-furo[3,2-c]pyran-2(6H)-one, also known by its CAS number 70402-10-7, is a chemical compound characterized by its unique fused ring structure that combines a furan and pyran moiety. This compound typically exhibits a hydroxyl group at the 6-position, contributing to its reactivity and potential biological activity. It is often studied for its potential applications in pharmaceuticals and natural product chemistry due to its structural features that may influence its interaction with biological systems. The presence of the furan and pyran rings suggests that it may participate in various chemical reactions, including those involving electrophilic and nucleophilic sites. Additionally, compounds of this type may exhibit antioxidant properties, making them of interest in the study of health-related applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in experimental settings. Overall, 6-hydroxy-4H-furo[3,2-c]pyran-2(6H)-one represents a fascinating subject for further research in organic and medicinal chemistry.

Formula: C₇H₆O₄

InChI: InChI=1/C7H6O4/c8-6-2-5-4(3-10-6)1-7(9)11-5/h1-2,6,8H,3H2

SMILES: C1=C2COC(C=C2OC1=O)O

Synonyms:

• 4H-Furo(3,2-c)pyran-2(6H)-one, 6-hydroxy-

Neopatulin

CAS: 70402-10-7

Formula: C₇H₆O₄

Molecular weight: 154.12

Ref: 4Z-N-125001

Neopatulin

Controlled Product

CAS: 70402-10-7

Applications Neopatulin is a mycotoxic substance which is produced by Penicillium and Aspergillus species. The molecule possesses useful antibiotic and antibacterial properties, but it is also an unwelcome contaminant in food and a general plant toxin.
References Ellis, J.R., et al.: Appl. Microbiol., 25, 562 (1973), Priest, J.W., et al.: Biochemistry, 28,  9192 (1989),

Formula: C₇H₆O₄

Color and Shape: Neat

Molecular weight: 154.12

Ref: TR-N389860

Neopatulin

CAS: 70402-10-7

Neopatulin is a naturally occurring compound classified as a bioactive agent, which is derived from certain species of fungi, particularly from Penicillium. Its mode of action involves disrupting microbial cell function, making it effective as an antimicrobial agent. The compound interferes with cell wall synthesis and metabolic processes of the microorganisms, ultimately inhibiting their growth and proliferation.

Formula: C₇H₆O₄

Purity: Min. 95%

Molecular weight: 154.12 g/mol

Ref: 3D-VCA40210