CAS 70403-32-6

4-(2-Piperazinylmethyl)morpholine

Description:

4-(2-Piperazinylmethyl)morpholine, with the CAS number 70403-32-6, is a chemical compound characterized by its unique structure that combines a morpholine ring with a piperazine moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and various organic solvents, which enhances its utility in different chemical applications. The presence of both morpholine and piperazine groups suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting central nervous system disorders. Additionally, the compound may exhibit basic properties due to the nitrogen atoms in its structure, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₁₉N₃O

InChI: InChI=1S/C9H19N3O/c1-2-11-9(7-10-1)8-12-3-5-13-6-4-12/h9-11H,1-8H2

InChI key: InChIKey=GRVJXWHAFWTUOA-UHFFFAOYSA-N

SMILES: C(C1CNCCN1)N2CCOCC2

Synonyms:

• 4-(2-Piperazinylmethyl)morpholine
• Morpholine, 4-(2-piperazinylmethyl)-