CymitQuimica logo

CAS 70407-20-4

:

Territrem B

Description:
Territrem B is a secondary metabolite produced by certain fungi, particularly from the genus Aspergillus. It is classified as a terpenoid compound, which is characterized by its complex structure and biological activity. This compound exhibits a range of interesting properties, including potential antimicrobial and cytotoxic effects, making it a subject of interest in pharmacological research. Territrem B has been studied for its ability to inhibit the growth of various pathogens, which may have implications for developing new antimicrobial agents. Additionally, its unique structural features contribute to its reactivity and interactions with biological systems. As with many natural products, the synthesis and extraction of Territrem B can be challenging, and ongoing research aims to explore its full potential in medicinal chemistry and biotechnology. Overall, Territrem B represents a fascinating example of how natural compounds can lead to significant advancements in health and medicine.
Formula:C29H34O9
InChI:InChI=1S/C29H34O9/c1-25(2)9-8-22(30)27(4)28(25,32)11-10-26(3)29(27,33)15-17-19(38-26)14-18(37-24(17)31)16-12-20(34-5)23(36-7)21(13-16)35-6/h8-9,12-14,32-33H,10-11,15H2,1-7H3/t26-,27+,28-,29-/m1/s1
InChI key:InChIKey=PBXNNDFKPQPJBB-VJLHXPKFSA-N
SMILES:O[C@@]12[C@]3(C)[C@@](O)(CC[C@@]1(C)OC4=C(C2)C(=O)OC(=C4)C5=CC(OC)=C(OC)C(OC)=C5)C(C)(C)C=CC3=O
Synonyms:
  • (4aR,6aR,12aS,12bS)-4a,6,6a,12,12a,12b-Hexahydro-4a,12a-dihydroxy-4,4,6a,12b-tetramethyl-9-(3,4,5-trimethoxyphenyl)-4H,11H-naphtho[2,1-b]pyrano[3,4-e]pyran-1,11(5H)-dione
  • 4H,11H-Naphtho[2,1-b]pyrano[3,4-e]pyran-1,11(5H)-dione, 4a,6,6a,12,12a,12b-hexahydro-4a,12a-dihydroxy-4,4,6a,12b-tetramethyl-9-(3,4,5-trimethoxyphenyl)-, [4aR-(4aα,6aβ,12aα,12bβ)]-
  • 4H,11H-naphtho[2,1-b]pyrano[3,4-e]pyran-1,11(5H)-dione, 4a,6,6a,12,12a,12b-hexahydro-4a,12a-dihydroxy-4,4,6a,12b-tetramethyl-9-(3,4,5-trimethoxyphenyl)-, (4aR,6aR,12aS,12bS)-
  • Territrem B
  • (4aR,6aR,12aS,12bS)-4a,12a-Dihydroxy-4,4,6a,12b-tetramethyl-9-(3,4,5-trimethoxyphenyl)-4a,6,6a,12,12a,12b-hexahydro-4H,11H-benzo[f]pyrano[4,3-b]chromene-1,11(5H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.