CAS 7041-50-1

2-Bromo-4-mercaptobenzoic Acid

Description:

2-Bromo-4-mercaptobenzoic acid is an organic compound characterized by the presence of a bromine atom and a thiol (-SH) group attached to a benzoic acid structure. This compound features a benzene ring substituted with a bromine atom at the second position and a mercapto group at the fourth position relative to the carboxylic acid group. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid and thiol functional groups. The compound exhibits acidic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its thiol group can also engage in redox reactions, making it useful in various applications, including pharmaceuticals and organic synthesis. Additionally, the presence of the bromine atom can enhance its reactivity, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as both brominated compounds and thiols can pose health risks.

Formula: C₇H₅BrO₂S

InChI: InChI=1/C7H5BrO2S/c8-6-3-4(11)1-2-5(6)7(9)10/h1-3,11H,(H,9,10)

SMILES: c1cc(c(cc1S)Br)C(=O)O

Synonyms:

• 2-Bromo-4-Sulfanylbenzoic Acid