CAS 70415-59-7
:3-[methyl(nitroso)amino]propan-1-ol
Description:
3-[Methyl(nitroso)amino]propan-1-ol, with the CAS number 70415-59-7, is a chemical compound characterized by its structure, which includes a propanol backbone with a methyl group and a nitroso group attached to an amino functional group. This compound is typically classified as an organic nitroso compound, which can exhibit unique reactivity due to the presence of the nitroso group. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and boiling point. The methyl group contributes to the overall hydrophobic character of the molecule. Compounds like this may have applications in various fields, including pharmaceuticals and agrochemicals, but their stability and reactivity can vary significantly based on environmental conditions. Safety considerations are important, as nitroso compounds can be associated with potential health risks, including carcinogenicity. Therefore, handling and usage should be approached with caution, adhering to appropriate safety protocols.
Formula:C4H10N2O2
InChI:InChI=1/C4H10N2O2/c1-6(5-8)3-2-4-7/h7H,2-4H2,1H3
SMILES:CN(CCCO)N=O
Synonyms:- 1-Propanol, 3-(Methylnitrosoamino)-
- 3-[Methyl(nitroso)amino]-1-propanol
- 70415-59-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-[methyl(nitroso)amino]propan-1-ol
CAS:Formula:C4H10N2O2Color and Shape:LiquidMolecular weight:118.1344N-Nitroso-methyl(3-hydroxypropyl)amine
CAS:Formula:C4H10N2O2Color and Shape:Colourless To Light YellowMolecular weight:118.133-(Methylnitrosoamino)-1-propanol
CAS:Controlled ProductFormula:C4H10N2O2Color and Shape:NeatMolecular weight:118.13


