CAS 70416-51-2

6-Bromo-5-cyano-3-pyridinecarboxylic acid

Description:

6-Bromo-5-cyano-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position and a cyano group at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in organic synthesis and medicinal chemistry. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, the presence of both electron-withdrawing and electron-donating groups can influence its chemical behavior, including reactivity in nucleophilic substitution reactions and potential coordination with metal ions. Overall, 6-Bromo-5-cyano-3-pyridinecarboxylic acid is a versatile compound with significant implications in various fields of chemistry.

Formula: C₇H₃BrN₂O₂

InChI: InChI=1S/C7H3BrN2O2/c8-6-4(2-9)1-5(3-10-6)7(11)12/h1,3H,(H,11,12)

InChI key: InChIKey=BMPOVMSBQFFROA-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C(O)=O)C=NC1Br

Synonyms:

• 3-Pyridinecarboxylic acid, 6-bromo-5-cyano-
• 6-Bromo-5-cyano-3-pyridinecarboxylic acid

6-Bromo-5-cyanonicotinic acid

CAS: 70416-51-2

Formula: C₇H₃BrN₂O₂

Molecular weight: 227.0149

Ref: IN-DA01ECPH