CAS 70416-53-4

5-formylpyridine-3-carbonitrile

Description:

5-Formylpyridine-3-carbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a formyl group (-CHO) and a cyano group (-CN) attached to the pyridine ring, specifically at the 5 and 3 positions, respectively. This structural arrangement contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of both the formyl and cyano groups allows for various chemical transformations, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit polar characteristics due to the electronegative nitrogen and the functional groups, influencing its solubility in different solvents. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. As with many organic compounds, safety precautions should be observed when handling 5-formylpyridine-3-carbonitrile, as it may pose health risks or environmental hazards.

Formula: C₇H₄N₂O

InChI: InChI=1/C7H4N2O/c8-2-6-1-7(5-10)4-9-3-6/h1,3-5H

SMILES: c1c(C#N)cncc1C=O

Synonyms:

• 3-Pyridinecarbonitrile, 5-Formyl-
• 5-Formylnicotinonitrile
• 5-Fornyl-3-pyridinecarbonitrile

5-Formyl-3-pyridinecarbonitrile

CAS: 70416-53-4

Formula: C₇H₄N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 132.1195

Ref: IN-DA0036RK

5-Formyl-3-pyridinecarbonitrile

CAS: 70416-53-4

5-Formyl-3-pyridinecarbonitrile

Purity: 96%

Molecular weight: 132.12g/mol

Ref: 54-OR927407

5-Formylnicotinonitrile

CAS: 70416-53-4

Formula: C₇H₄N₂O

Purity: 97%

Color and Shape: White powder

Molecular weight: 132.122

Ref: 10-F220354