
CAS 70419-11-3
:(-)-1,5-Dimethylhexylamine
Description:
(-)-1,5-Dimethylhexylamine, with the CAS number 70419-11-3, is an organic compound classified as an aliphatic amine. It features a hexyl chain with two methyl groups attached to the first and fifth carbon atoms, contributing to its chiral nature. This compound is typically a colorless to pale yellow liquid with a characteristic amine odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic hexyl chain. (-)-1,5-Dimethylhexylamine is known for its potential applications in various fields, including as a building block in organic synthesis and in the production of surfactants or pharmaceuticals. Its chiral nature may impart specific biological activities, making it of interest in medicinal chemistry. Safety considerations include its classification as a potentially irritating substance, necessitating proper handling and storage to minimize exposure. As with many amines, it may undergo reactions typical of amines, such as alkylation and acylation, which can be leveraged in synthetic pathways.
Formula:C8H19N
InChI:InChI=1S/C8H19N/c1-7(2)5-4-6-8(3)9/h7-8H,4-6,9H2,1-3H3/t8-/m1/s1
InChI key:InChIKey=QNIVIMYXGGFTAK-MRVPVSSYSA-N
SMILES:C(CC(C)C)C[C@@H](C)N
Synonyms:- (-)-2-Amino-6-methylheptane
- (2R)-6-Methyl-2-heptanamine
- 2-Heptanamine, 6-methyl-, (R)-
- (R)-2-Amino-6-methylheptane
- 2-Heptanamine, 6-methyl-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.