CAS 70424-62-3
:Octanoyl salicylic acid
Description:
Octanoyl salicylic acid, with the CAS number 70424-62-3, is an ester derived from salicylic acid and octanoic acid. This compound is characterized by its unique structure, which combines the properties of both salicylic acid, known for its anti-inflammatory and exfoliating effects, and octanoic acid, a fatty acid that contributes to its lipophilicity. Octanoyl salicylic acid is typically a white to off-white solid or powder, and it is soluble in organic solvents while exhibiting limited solubility in water. Its primary applications are found in the cosmetic and pharmaceutical industries, where it is utilized for its potential benefits in skin care formulations, particularly for acne treatment and skin exfoliation. The compound is also noted for its ability to enhance the penetration of active ingredients through the skin barrier, making it a valuable ingredient in topical formulations. Additionally, it may possess antimicrobial properties, further contributing to its efficacy in skin care applications.
Formula:C15H20O4
InChI:InChI=1S/C15H20O4/c1-2-3-4-5-6-11-14(16)19-13-10-8-7-9-12(13)15(17)18/h7-10H,2-6,11H2,1H3,(H,17,18)
InChI key:InChIKey=LKLYETYHDMXRAF-UHFFFAOYSA-N
SMILES:O(C(CCCCCCC)=O)C1=C(C(O)=O)C=CC=C1
Synonyms:- Mexoryl SAB
- o-Octanoyloxybenzoic acid
- Benzoic acid, 2-[(1-oxooctyl)oxy]-
- 2-[(1-Oxooctyl)oxy]benzoic acid
- Octanoic acid, ester with salicylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
