CymitQuimica logo

CAS 70441-03-1

:

7-hydroxyspiro[chromene-2,1'-cyclopentan]-4(3H)-one

Description:
7-Hydroxyspiro[chromene-2,1'-cyclopentan]-4(3H)-one, with the CAS number 70441-03-1, is a chemical compound characterized by its unique spirocyclic structure, which combines a chromene moiety with a cyclopentanone. This compound typically exhibits properties associated with both chromenes and cyclopentanones, including potential biological activity. It may possess antioxidant, anti-inflammatory, or antimicrobial properties, making it of interest in pharmaceutical and medicinal chemistry. The presence of the hydroxyl group at the 7-position enhances its reactivity and solubility in polar solvents. Additionally, the spiro structure contributes to its rigidity and may influence its interaction with biological targets. The compound's synthesis often involves multi-step organic reactions, and its stability can be affected by environmental factors such as light and temperature. Overall, 7-hydroxyspiro[chromene-2,1'-cyclopentan]-4(3H)-one represents a fascinating subject for research in organic chemistry and drug development due to its structural complexity and potential applications.
Formula:C13H14O3
InChI:InChI=1/C13H14O3/c14-9-3-4-10-11(15)8-13(5-1-2-6-13)16-12(10)7-9/h3-4,7,14H,1-2,5-6,8H2
SMILES:C1CCC2(C1)CC(=O)c1ccc(cc1O2)O
Synonyms:
  • Spiro[2H-1-benzopyran-2,1'-cyclopentan]-4(3H)-one, 7-hydroxy-
  • 7-Hydroxyspiro[chromene-2,1'-cyclopentan]-4(3H)-one
  • 7-HYDROXYSPIRO[CHROMAN-2,1'-CYCLOPENTAN]-4-ONE
  • 7-Hydroxyspiro[chromane-2,1'-cyclopentan]-4-one
  • 7-hydroxy-3,4-dihydrospiro[1-benzopyran-2,1-cyclopentan]-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.