CAS 70441-63-3
:4-Fluoro-N-(1-methylethyl)benzenamine
Description:
4-Fluoro-N-(1-methylethyl)benzenamine, also known by its CAS number 70441-63-3, is an organic compound characterized by the presence of a fluorine atom and an isopropyl group attached to a benzene ring. This compound features an amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions. The fluorine substituent can influence the compound's electronic properties, making it more polar and potentially affecting its solubility in different solvents. The isopropyl group adds steric bulk, which can impact the compound's reactivity and interactions with other molecules. Typically, compounds like this may be used in the synthesis of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety and handling precautions are essential, as with many amines and fluorinated compounds, due to potential toxicity and environmental impact.
Formula:C9H12FN
InChI:InChI=1S/C9H12FN/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,11H,1-2H3
InChI key:InChIKey=RMXBOQCXULAXBO-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=CC=C(F)C=C1
Synonyms:- 4-Fluoro-N-(1-methylethyl)benzenamine
- 4-Fluoro-N-isopropylaniline
- Benzenamine, 4-fluoro-N-(1-methylethyl)-
- Fipa
- N-(4-Fluorophenyl)-N-isopropylamine
- N-(4-Fluorophenyl)isopropylamine
- N-Isopropyl-4-fluoroaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Fluoro-N-isopropylaniline
CAS:Formula:C9H12FNPurity:96%Color and Shape:LiquidMolecular weight:153.19674-Fluoro-N-isopropylaniline
CAS:4-Fluoro-N-isopropylaniline is an organic compound that is a nitroarene with the chemical formula C6H5FNO2. It is soluble in organic solvents and reacts with halogens, alkoxy groups, or polysubstituted alkyl groups to form substituted or polysubstituted alkyl radicals. 4-Fluoro-N-isopropylaniline can be used as a catalyst for many reactions including those involving alkoxycarbonyl groups. This compound is also used as a reagent in the synthesis of other compounds such as 4-fluoroaniline, which can be used to synthesize dyes and pharmaceuticals.Formula:C9H12FNPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:153.2 g/mol4-Fluoro-N-isopropylaniline-13C6
CAS:Controlled ProductApplications 4-Fluoro-N-isopropylaniline-13C6 is an intermediate for the synthesis of Flufenacet-13C6 (F599422), labelled Flufenacet (F599420) which is an anilide based herbicide that is applied to the soil surface or incorporated before the crop is emerged. Flufenacet is often used in field corn, corn grown for silage or soybeans to control annual grasses and broadleaf weeds.
References Hulting, A.G., et al.: Weed. Technol., 26, 230 (2012); Bailly, G.C., et al.: Crop Protect., 34, 96 (2012)Formula:C6C3H12FNColor and Shape:NeatMolecular weight:159.153






