CAS 7045-70-7
:1,3-Diisopropylcyclohexane
Description:
1,3-Diisopropylcyclohexane is an organic compound characterized by its cyclohexane ring substituted with two isopropyl groups at the 1 and 3 positions. This compound is a colorless liquid at room temperature and is known for its relatively low volatility and moderate solubility in organic solvents. Its molecular structure contributes to its hydrophobic nature, making it less soluble in water. The presence of the isopropyl groups introduces steric hindrance, which affects the compound's reactivity and physical properties, such as boiling and melting points. 1,3-Diisopropylcyclohexane is often used in organic synthesis and as a solvent in various chemical reactions. Its stability and non-polar characteristics make it suitable for applications in the chemical industry, particularly in processes requiring non-polar solvents. Additionally, it is important to handle this compound with care, as with many organic solvents, due to potential health hazards associated with inhalation or skin contact.
Formula:C12H24
InChI:InChI=1/C12H24/c1-9(2)11-6-5-7-12(8-11)10(3)4/h9-12H,5-8H2,1-4H3
SMILES:CC(C)C1CCCC(C1)C(C)C
Synonyms:- 1,3-Di(Propan-2-Yl)Cyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

