CAS 70460-18-3
:2-(3-hydroxyphenyl)-4H-chromen-4-one
Description:
2-(3-Hydroxyphenyl)-4H-chromen-4-one, also known as a flavonoid compound, exhibits several notable characteristics. This substance features a chromone backbone, which is a fused benzopyran structure, and is substituted with a hydroxyl group on the phenyl ring. The presence of the hydroxyl group contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. The compound is typically characterized by its ability to absorb ultraviolet light, which can be attributed to the conjugated double bond system within its structure. This property is often utilized in studies related to its photostability and reactivity. Additionally, 2-(3-hydroxyphenyl)-4H-chromen-4-one may exhibit biological activities such as anti-inflammatory, antimicrobial, and anticancer effects, although specific activities can vary based on the context of use and concentration. Its solubility and stability in different solvents can also influence its application in research and industry. Overall, this compound represents a significant area of interest in the field of natural products and medicinal chemistry.
Formula:C15H10O3
InChI:InChI=1/C15H10O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-9,16H
SMILES:c1ccc2c(c1)c(=O)cc(c1cccc(c1)O)o2
Synonyms:- 3'-Hydroxyflavone
- 4H-1-benzopyran-4-one, 2-(3-hydroxyphenyl)-
- 70460-18-3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-hydroxyflavone
CAS:Oxygen-heterocyclic compoundFormula:C15H10O3Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:238.243'-Hydroxyflavone
CAS:3'-Hydroxyflavone is a bioactive flavonoid compound, which is derived from natural plant sources. It is commonly isolated from various fruits, vegetables, and leaves where it functions as a secondary metabolite, contributing to the plant's defense mechanisms. The compound exhibits its mode of action primarily through its ability to scavenge free radicals, thus exerting strong antioxidant effects. This ability to neutralize oxidative stress at the cellular level makes it a compound of interest for numerous biological and pharmacological studies.
Formula:C15H10O3Purity:Min. 95%Molecular weight:238.24 g/molRef: 3D-VCA46018
Discontinued product

