CAS 70476-63-0

1,4-bis{[2-(dimethylamino)ethyl]amino}-5,8-dihydroxyanthracene-9,10-dione

Description:

1,4-bis{[2-(dimethylamino)ethyl]amino}-5,8-dihydroxyanthracene-9,10-dione, commonly referred to as a derivative of anthraquinone, is a synthetic organic compound characterized by its complex structure that includes multiple functional groups. This compound features two dimethylaminoethyl substituents, which enhance its solubility and potential biological activity. The presence of hydroxyl groups contributes to its reactivity and may influence its interaction with biological systems. Typically, compounds of this nature exhibit properties such as fluorescence, making them useful in various applications, including dyes, pigments, and potentially in medicinal chemistry for their therapeutic properties. The anthraquinone core is known for its stability and ability to undergo redox reactions, which can be leveraged in various chemical processes. Additionally, the compound's molecular structure suggests potential for interactions with biomolecules, indicating possible roles in drug development or as a biochemical probe. However, specific safety and handling guidelines should be followed due to the presence of nitrogen-containing groups, which may pose health risks.

Formula: C₂₂H₂₈N₄O₄

InChI: InChI=1/C22H28N4O4/c1-25(2)11-9-23-13-5-6-14(24-10-12-26(3)4)18-17(13)21(29)19-15(27)7-8-16(28)20(19)22(18)30/h5-8,23-24,27-28H,9-12H2,1-4H3

SMILES: CN(C)CCNc1ccc(c2c1C(=O)c1c(ccc(c1C2=O)O)O)NCCN(C)C

Synonyms:

• 1,4-Bis{[2-(dimethylamino)ethyl]amino}-5,8-dihydroxy-9,10-anthraquinone
• 9,10-Anthracenedione, 1,4-bis((2-(dimethylamino)ethyl)amino)-5,8-dihydroxy-
• 1,4-Bis((2-(dimethylamino)ethyl)amino)-5,8-dihydroxyanthracene-9,10-dione
• 1,4-Bis[[2-(dimethylamino)ethyl]amino]-5,8-dihydroxy-9,10-anthracenedione
• AQ4

AQ4

CAS: 70476-63-0

AQ4

Purity: ≥95%

Molecular weight: 412.48g/mol

Ref: 54-BUP14145

AQ4

CAS: 70476-63-0

Formula: C₂₂H₂₈N₄O₄

Molecular weight: 412.48

Ref: 7W-GL2802

AQ4

CAS: 70476-63-0

AQ4 is a topoisomerase II inhibitor and DNA-inserting agent that inhibits proliferation and induces apoptosis in two cell lines.

Formula: C₂₂H₂₈N₄O₄

Purity: 96.28% - 97.15%

Color and Shape: Solid

Molecular weight: 412.48

Ref: TM-T23750