CymitQuimica logo

CAS 704869-38-5

:

SUN11602

Description:
SUN11602, with the CAS number 704869-38-5, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized by its unique molecular structure, which includes specific functional groups that contribute to its biological activity. The compound is typically evaluated for its pharmacokinetic properties, such as solubility, stability, and bioavailability, which are crucial for its effectiveness as a drug candidate. Additionally, SUN11602 may exhibit specific interactions with biological targets, making it a subject of interest in drug discovery and development. Its safety profile, including toxicity and side effects, is also a critical aspect of its characterization. Overall, SUN11602 represents a promising entity in the ongoing research aimed at developing new therapeutic agents. Further studies are essential to fully understand its mechanisms of action and potential applications in treating various diseases.
Formula:C26H37N5O2
InChI:InChI=1S/C26H37N5O2/c1-16-18(3)25(19(4)17(2)24(16)27)29-14-23(32)30(5)22-10-12-31(13-11-22)15-20-6-8-21(9-7-20)26(28)33/h6-9,22,29H,10-15,27H2,1-5H3,(H2,28,33)
InChI key:KCODNOOPOPTZMO-UHFFFAOYSA-N
SMILES:CC1=C(C(=C(C(=C1N)C)C)NCC(=O)N(C)C2CCN(CC2)CC3=CC=C(C=C3)C(=O)N)C
Found 3 products.