CAS 704884-79-7
:2-[(Dimethylamino)methyl]-4-(trifluoromethoxy)phenol
Description:
2-[(Dimethylamino)methyl]-4-(trifluoromethoxy)phenol, with the CAS number 704884-79-7, is an organic compound characterized by its phenolic structure, which includes a dimethylamino group and a trifluoromethoxy substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate due to its functional groups. The presence of the dimethylamino group suggests basicity, while the trifluoromethoxy group may impart unique electronic properties and influence solubility. The compound's molecular interactions can be significant, particularly in biological systems, where it may act as a ligand or influence enzyme activity. Its synthesis and handling require standard laboratory safety protocols due to the presence of fluorinated components, which can be hazardous. Overall, this compound's unique structure and functional groups make it of interest in various chemical research and development contexts.
Formula:C10H12F3NO2
InChI:InChI=1S/C10H12F3NO2/c1-14(2)6-7-5-8(3-4-9(7)15)16-10(11,12)13/h3-5,15H,6H2,1-2H3
InChI key:InChIKey=RMMZUQRYXJGXHJ-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=CC(OC(F)(F)F)=CC=C1O
Synonyms:- 2-[(Dimethylamino)methyl]-4-(trifluoromethoxy)phenol
- [2-Hydroxy-5-(trifluoromethoxy)phenyl]-N,N-dimethylmethanamine
- Phenol, 2-[(dimethylamino)methyl]-4-(trifluoromethoxy)-
- 2-DIMETHYLAMINOMETHYL-4-TRIFLUOROMETHOXY-PHENOL
- 2-HYDROXY-5-(TRIFLUOROMETHOXY)-N,N-DIMETHYLBENZYLAMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.