CymitQuimica logo

CAS 704884-80-0

:

2-[(Dimethylamino)methyl]-3,4,5-trifluorophenol

Description:
2-[(Dimethylamino)methyl]-3,4,5-trifluorophenol, with the CAS number 704884-80-0, is an organic compound characterized by the presence of a phenolic group substituted with trifluoromethyl groups and a dimethylamino group. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The trifluoromethyl groups contribute to its unique electronic properties, enhancing its reactivity and potential applications in various chemical reactions. The dimethylamino group imparts basic characteristics, making the compound potentially useful in medicinal chemistry and as a building block in the synthesis of more complex molecules. Additionally, the presence of fluorine atoms can influence the compound's lipophilicity and biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as compounds with similar structures may exhibit toxicity or environmental hazards. Overall, this compound's unique structure and properties make it a subject of interest in both academic and industrial chemistry.
Formula:C9H10F3NO
InChI:InChI=1S/C9H10F3NO/c1-13(2)4-5-7(14)3-6(10)9(12)8(5)11/h3,14H,4H2,1-2H3
InChI key:InChIKey=MPHZDBWEYMJVTK-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=C(F)C(F)=C(F)C=C1O
Synonyms:
  • Phenol, 2-[(dimethylamino)methyl]-3,4,5-trifluoro-
  • 2-[(Dimethylamino)methyl]-3,4,5-trifluorophenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.