CymitQuimica logo

CAS 704885-44-9

:

β-D-Glucopyranosiduronic acid, 4-formyl-2-methoxyphenyl, methyl ester, 2,3,4-triacetate

Description:
β-D-Glucopyranosiduronic acid, 4-formyl-2-methoxyphenyl, methyl ester, 2,3,4-triacetate, with CAS number 704885-44-9, is a complex organic compound characterized by its glucuronic acid backbone modified with various functional groups. This compound features a methoxyphenyl group, which contributes to its aromatic properties, and multiple acetate groups that enhance its solubility and reactivity. The presence of the formyl group indicates potential reactivity, particularly in condensation reactions. As a derivative of glucuronic acid, it may participate in biological processes, including detoxification pathways, where glucuronidation is a key mechanism. The acetylation of hydroxyl groups can influence its stability and interaction with biological molecules. This compound may be of interest in medicinal chemistry and biochemistry for its potential applications in drug development or as a biochemical probe. Its structural complexity suggests that it could exhibit unique physical and chemical properties, including solubility in organic solvents and potential bioactivity, warranting further investigation in relevant scientific fields.
Formula:C21H24O12
InChI:InChI=1S/C21H24O12/c1-10(23)29-16-17(30-11(2)24)19(31-12(3)25)21(33-18(16)20(26)28-5)32-14-7-6-13(9-22)8-15(14)27-4/h6-9,16-19,21H,1-5H3/t16-,17-,18-,19+,21+/m0/s1
InChI key:InChIKey=QTHPZBHVIGLWPP-VDRZXAFZSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C(OC)=O)O[C@H]1OC2=C(OC)C=C(C=O)C=C2
Synonyms:
  • β-D-Glucopyranosiduronic acid, 4-formyl-2-methoxyphenyl, methyl ester, 2,3,4-triacetate
  • β-D-Glucopyranosiduronic acid, 4-formyl-2-methoxyphenyl, methyl ester, triacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.