CymitQuimica logo

CAS 704910-17-8

:

L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-2-propenyl-

Description:
L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-2-propenyl- is a synthetic derivative of the amino acid L-serine, which is crucial for protein synthesis and various metabolic processes. This compound features a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly used in peptide synthesis to protect the amino group during the coupling reactions. The presence of the O-2-propenyl group suggests that it may be involved in further chemical modifications or reactions, potentially enhancing its reactivity or solubility. The compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit stability under standard laboratory conditions. Its molecular structure indicates potential applications in peptide synthesis, drug development, or as a biochemical probe. As with many synthetic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a specialized tool in organic and medicinal chemistry, particularly in the context of peptide synthesis and modification.
Formula:C21H21NO5
InChI:InChI=1S/C21H21NO5/c1-2-11-26-13-19(20(23)24)22-21(25)27-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,22,25)(H,23,24)/t19-/m0/s1
InChI key:BFEBKKIRUYSHKY-IBGZPJMESA-N
SMILES:C=CCOC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Found 4 products.