CAS 70499-13-7

7-Chloro-2-methyl-4(1H)-quinolinone

Description:

7-Chloro-2-methyl-4(1H)-quinolinone, with the CAS number 70499-13-7, is a heterocyclic organic compound belonging to the quinolinone family. This compound features a quinoline backbone, which is characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. The presence of a chlorine atom at the 7-position and a methyl group at the 2-position contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structure allows for various chemical modifications, which can enhance its pharmacological profile. As with many quinolinone derivatives, it may also serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₈ClNO

InChI: InChI=1S/C10H8ClNO/c1-6-4-10(13)8-3-2-7(11)5-9(8)12-6/h2-5H,1H3,(H,12,13)

InChI key: InChIKey=TWYVITBRDNFBNT-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(C)=C1)=CC(Cl)=CC2

Synonyms:

• 4(1H)-Quinolinone, 7-chloro-2-methyl-
• 7-Chloro-2-methyl-4-Quinolinone
• 2-Methyl-7-chloro-4-quinolone
• 7-Chloro-2-methyl-4(1H)-quinolinone