
CAS 705-02-2
:[(2-fluorophenyl)sulfanyl]acetate
Description:
[(2-Fluorophenyl)sulfanyl]acetate, with the CAS number 705-02-2, is an organic compound characterized by the presence of a fluorinated aromatic ring and a thioether functional group. The molecule features a 2-fluorophenyl group, which indicates that a fluorine atom is substituted at the second position of the phenyl ring, enhancing its reactivity and influencing its physical properties. The sulfanyl (thioether) group contributes to the compound's potential as a nucleophile in various chemical reactions. The acetate moiety suggests that the compound can participate in esterification and hydrolysis reactions. In terms of physical properties, compounds like this often exhibit moderate solubility in organic solvents and may have distinct melting and boiling points influenced by the presence of the fluorine atom and the overall molecular structure. The compound's unique characteristics make it of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds are often explored for their enhanced biological activity and stability.
Formula:C8H6FO2S
InChI:InChI=1/C8H7FO2S/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1
SMILES:c1ccc(c(c1)F)SCC(=O)[O-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[(2-Fluorophenyl)sulfanyl]acetic Acid
CAS:Controlled Product<p>Applications 2-[(2-fluorophenyl)sulfanyl]acetic acid (cas# 705-02-2) is used in the preparation of phenylsulfanylalkylcarboxylic acid compositions, useful for the delivery of active agents.<br>References Wang, N. F., et al.: PCT Int. Appl. 118 pp. (2008)<br></p>Formula:C8H7FO2SColor and Shape:NeatMolecular weight:186.203
