CAS 705-25-9

6-(Trifluoromethyl)-1,3,5-triazine-2,4-diamine

Description:

6-(Trifluoromethyl)-1,3,5-triazine-2,4-diamine, with the CAS number 705-25-9, is a heterocyclic compound characterized by its triazine ring structure, which contains three nitrogen atoms and is substituted with a trifluoromethyl group and two amino groups. This compound is typically a white to off-white solid and is known for its stability under various conditions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The amino groups contribute to its potential as a building block in organic synthesis and may also impart solubility in polar solvents. This compound is of interest in various fields, including agrochemicals and pharmaceuticals, due to its potential applications in herbicides and as a precursor for more complex molecules. Its chemical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.

Formula: C₄H₄F₃N₅

InChI: InChI=1/C4H4F3N5/c5-4(6,7)1-10-2(8)12-3(9)11-1/h(H4,8,9,10,11,12)

InChI key: InChIKey=AQTPBZVFBFDGDY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(N)N=C(N)N1

Synonyms:

• 2,4-Diamino-6-(trifluoromethyl)-s-triazine
• 2-Trifluoromethyl-4,6-diamino-s-triazine
• 1,3,5-Triazine-2,4-diamine, 6-(trifluoromethyl)-
• s-Triazine, 2,4-diamino-6-(trifluoromethyl)-
• 6-(Trifluoromethyl)-1,3,5-triazine-2,4-diamine