CAS 705-29-3
:3-(Trifluoromethyl)benzyl chloride
Description:
3-(Trifluoromethyl)benzyl chloride, with the CAS number 705-29-3, is an organic compound characterized by the presence of a benzyl group substituted with a trifluoromethyl group at the meta position. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group enhances the compound's stability and volatility. 3-(Trifluoromethyl)benzyl chloride is generally handled with care due to its potential toxicity and environmental impact, necessitating appropriate safety measures during storage and use.
Formula:C8H6ClF3
InChI:InChI=1S/C8H6ClF3/c9-5-6-2-1-3-7(4-6)8(10,11)12/h1-4H,5H2
InChI key:InChIKey=XGASTRVQNVVYIZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CCl)=CC=C1
Synonyms:- 1-(Chloromethyl)-3-(trifluoromethyl)benzene
- 3-(Trifluoromethyl)benzyl chloride
- 3-Chloromethyl-benzotrifluoride
- 3-Chloromethylbenzotrifluoride
- Benzene, 1-(chloromethyl)-3-(trifluoromethyl)-
- NSC 5227
- m-(Trifluoromethyl)benzyl chloride
- m-(α,α,α-Trifluoromethyl)benzyl chloride
- m-Xylene, α′-chloro-α,α,α-trifluoro-
- α-Chloro-3-(trifluoromethyl)toluene
- α′-Chloro-α,α,α-trifluoro-m-xylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-(Trifluoromethyl)benzyl Chloride
CAS:Formula:C8H6ClF3Purity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:194.583-(Trifluoromethyl)benzyl chloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6ClF3Purity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:194.583-(Trifluoromethyl)benzyl chloride
CAS:3-(Trifluoromethyl)benzyl chlorideFormula:C8H6ClF3Purity:98%Color and Shape: clear. colourless liquidMolecular weight:194.58g/mol3-(trifluoromethyl)benzyl chloride
CAS:Controlled ProductFormula:C8H6ClF3Color and Shape:NeatMolecular weight:194.5823-(Trifluoromethyl)benzyl chloride
CAS:Formula:C8H6ClF3Purity:98%Color and Shape:ClearMolecular weight:194.583-(Trifluoromethyl)benzyl chloride
CAS:3-(Trifluoromethyl)benzyl chloride is a chloromethylating agent that reacts with magnesium to form a magnesium chloride solution. 3-(Trifluoromethyl)benzyl chloride is also used in the synthesis of pharmaceuticals, pesticides, and dyes. The reaction produces small amounts of chlorinated byproducts such as chloride, which can be found in wastewater. This chemical has been shown to have adverse effects on the environment through its release into waterways or the atmosphere.
Formula:C8H6ClF3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:194.58 g/molBenzene, 1-(chloromethyl)-3-(trifluoromethyl)-
CAS:Formula:C8H6ClF3Purity:98%Color and Shape:LiquidMolecular weight:194.5814Ref: IN-DA003I7D
Discontinued product








