CymitQuimica logo

CAS 705-36-2

:

1-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid

Description:
1-Methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, with the CAS number 705-36-2, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which features two carbonyl (keto) groups and a carboxylic acid functional group. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals and biochemistry, particularly as an intermediate in the synthesis of various biologically active compounds. The presence of multiple functional groups allows for diverse reactivity, making it a valuable compound in organic synthesis. Additionally, its stability under standard conditions and the ability to form hydrogen bonds contribute to its solubility and reactivity profile. Overall, 1-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid is an important compound in the field of organic chemistry with potential applications in medicinal chemistry.
Formula:C6H6N2O4
InChI:InChI=1/C6H6N2O4/c1-8-4(9)2-3(5(10)11)7-6(8)12/h2H,1H3,(H,7,12)(H,10,11)
SMILES:Cn1c(=O)cc(C(=O)O)nc1O
Synonyms:
  • 1-(Methyl)orotic acid
  • 4-Pyrimidinecarboxylic Acid, 1,2,3,6-Tetrahydro-1-Methyl-2,6-Dioxo-
  • Methylorotic acid
  • Orotic acid, 1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.