CymitQuimica logo

CAS 705-82-8

:

2-(4-chloro-3-methylphenoxy)ethanol

Description:
2-(4-chloro-3-methylphenoxy)ethanol, with the CAS number 705-82-8, is an organic compound characterized by its ether and alcohol functional groups. It features a phenoxy group, which is a phenol derivative where a chlorine atom and a methyl group are substituted on the aromatic ring, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. Its structure allows for potential applications in various fields, including as an intermediate in the synthesis of agrochemicals or pharmaceuticals. The presence of the chloro and methyl substituents can influence its reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-(4-chloro-3-methylphenoxy)ethanol is a compound of interest due to its chemical structure and potential applications in various industries.
Formula:C9H11ClO2
InChI:InChI=1/C9H11ClO2/c1-7-6-8(12-5-4-11)2-3-9(7)10/h2-3,6,11H,4-5H2,1H3
SMILES:Cc1cc(ccc1Cl)OCCO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.