CAS 705-84-0

1-Fluoro-3-(2-nitrovinyl)benzene

Description:

1-Fluoro-3-(2-nitrovinyl)benzene, with the CAS number 705-84-0, is an organic compound characterized by the presence of a fluorine atom and a nitrovinyl group attached to a benzene ring. This compound features a fluorobenzene structure, where the fluorine atom is positioned at the meta position relative to the nitrovinyl substituent. The nitrovinyl group introduces both electron-withdrawing characteristics and potential reactivity due to the presence of the nitro group, which can influence the compound's chemical behavior and reactivity in various reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. The compound is typically a yellow to brown solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure makes it of interest in synthetic organic chemistry and materials science, particularly in the development of functional materials or as intermediates in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.

Formula: C₈H₆FNO₂

InChI: InChI=1/C8H6FNO2/c9-8-3-1-2-7(6-8)4-5-10(11)12/h1-6H/b5-4+

Synonyms:

• 1-(3-Fluorophenyl)-2-nitroethylene
• 3-Fluoro-beta-nitrostyrene
• 1-Fluoro-3-(2-Nitroethenyl)Benzene
• 1-fluoro-3-[(E)-2-nitroethenyl]benzene

1-Fluoro-3-(2-nitrovinyl)benzene

CAS: 705-84-0

Formula: C₈H₆FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.1371

Ref: IN-DA00676Z

1-Fluoro-3-(2-nitrovinyl)benzene

CAS: 705-84-0

1-Fluoro-3-(2-nitrovinyl)benzene

Purity: 95%

Molecular weight: 167.14g/mol

Ref: 54-PC201286

1-(3-Fluorophenyl)-2-nitroethene

CAS: 705-84-0

1-(3-Fluorophenyl)-2-nitroethene is a high quality reagent, complex compound, with CAS No. 705-84-0. It is used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. This compound is one of the most useful scaffolds for organic synthesis due to its versatility in reactions. 1-(3-Fluorophenyl)-2-nitroethene is a versatile building block that can be used in many different reactions, such as the formation of amides, esters, and lactams.

Formula: C₈H₆FNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 167.14 g/mol

Ref: 3D-FF66860

1-Fluoro-3-(2-nitrovinyl)benzene

CAS: 705-84-0

Formula: C₈H₆FNO₂

Purity: 95.0%

Molecular weight: 167.139

Ref: 10-F240147