CAS 70505-90-7

(4R)-4-ammonio-1'-methyl-3,4-dihydrospiro[chromene-2,4'-piperidinium]

Description:

(4R)-4-ammonio-1'-methyl-3,4-dihydrospiro[chromene-2,4'-piperidinium], with the CAS number 70505-90-7, is a quaternary ammonium compound characterized by its unique spirocyclic structure, which combines a chromene moiety with a piperidinium ring. This compound typically exhibits properties such as solubility in polar solvents due to its ionic nature, and it may display biological activity, making it of interest in medicinal chemistry. The presence of the ammonio group suggests potential interactions with biological membranes and receptors, which could influence its pharmacological profile. Additionally, the stereochemistry indicated by the (4R) designation implies specific spatial arrangements that can affect the compound's reactivity and interactions with other molecules. Overall, this compound's structural features contribute to its potential applications in various fields, including pharmaceuticals and materials science, where its unique properties can be harnessed for specific functions.

Formula: C₁₄H₂₂N₂O

InChI: InChI=1/C14H20N2O/c1-16-8-6-14(7-9-16)10-12(15)11-4-2-3-5-13(11)17-14/h2-5,12H,6-10,15H2,1H3/p+2/t12-/m1/s1

1'-Methyl-3,4-dihydrospiro[chromene-2,4'-piperidin]-4-amine, HCl

CAS: 70505-90-7

Formula: C₁₄H₂₀N₂O

Molecular weight: 232.3214

Ref: IN-DA005IGS

1'-methyl-3,4-dihydrospiro[1-benzopyran-2,4'-piperidin]-4-amine

CAS: 70505-90-7

Purity: 95.0%

Molecular weight: 232.32699584960938

Ref: 10-F521146

1'-Methyl-3,4-dihydrospiro[1-benzopyran-2,4'-piperidine]-4-amine

CAS: 70505-90-7

Versatile small molecule scaffold

Formula: C₁₄H₂₀N₂O

Purity: Min. 95%

Molecular weight: 232.32 g/mol

Ref: 3D-VCA50590