CAS 70505-91-8
:3,4-Dihydro-2-(1-methylethyl)-2H-1-benzopyran-4-amine
Description:
3,4-Dihydro-2-(1-methylethyl)-2H-1-benzopyran-4-amine, with the CAS number 70505-91-8, is a chemical compound that belongs to the class of benzopyran derivatives. This substance features a bicyclic structure that includes a benzene ring fused to a pyran ring, which contributes to its unique chemical properties. The presence of an amine functional group indicates potential basicity and reactivity, particularly in forming hydrogen bonds. The isopropyl group (1-methylethyl) attached to the benzopyran structure may influence its steric and electronic properties, potentially affecting its biological activity and solubility. Compounds of this type are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is analyzed. Overall, 3,4-Dihydro-2-(1-methylethyl)-2H-1-benzopyran-4-amine represents a structurally interesting compound with potential implications in various fields of research.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c1-8(2)12-7-10(13)9-5-3-4-6-11(9)14-12/h3-6,8,10,12H,7,13H2,1-2H3
InChI key:InChIKey=QQKDXQOPZWWMNG-UHFFFAOYSA-N
SMILES:NC1C=2C(OC(C(C)C)C1)=CC=CC2
Synonyms:- 3,4-Dihydro-2-(1-methylethyl)-2H-1-benzopyran-4-amine
- 2-(Propan-2-yl)-3,4-dihydro-2H-1-benzopyran-4-amine
- 2H-1-Benzopyran-4-amine, 3,4-dihydro-2-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.