CAS 7051-13-0

1-Chloro-2,4-dimethoxybenzene

Description:

1-Chloro-2,4-dimethoxybenzene, with the CAS number 7051-13-0, is an organic compound characterized by a benzene ring substituted with two methoxy groups and one chlorine atom. Its molecular formula is C9H11ClO2, indicating the presence of carbon, hydrogen, chlorine, and oxygen. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its aromatic properties and is often used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, the methoxy groups contribute to its electron-donating characteristics, influencing its reactivity and solubility in organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and proper storage conditions should be maintained to ensure stability.

Formula: C₈H₉ClO₂

InChI: InChI=1/C8H9ClO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3

SMILES: COc1ccc(c(c1)OC)Cl

Synonyms:

• Benzene, 1-chloro-2,4-dimethoxy-

1-Chloro-2,4-dimethoxybenzene

CAS: 7051-13-0

Formula: C₈H₉ClO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 172.6089

Ref: IN-DA005IGN

1-Chloro-2,4-dimethoxybenzene

CAS: 7051-13-0

1-Chloro-2,4-dimethoxybenzene

Purity: 98%

Molecular weight: 172.60886g/mol

Ref: 54-OR1020988

1-Chloro-2,4-dimethoxybenzene

CAS: 7051-13-0

Formula: C₈H₉ClO₂

Purity: 95%+

Color and Shape: Liquid

Molecular weight: 172.61

Ref: 10-F018365