CAS 70523-22-7
:1,2-dihydro-2-oxopyrimidin-5-yl-5-boronic acid
Description:
1,2-Dihydro-2-oxopyrimidin-5-yl-5-boronic acid, with the CAS number 70523-22-7, is a boronic acid derivative that features a pyrimidine ring structure. This compound typically exhibits characteristics common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyrimidine moiety contributes to its potential biological activity, as pyrimidines are often found in nucleic acids and other biologically relevant molecules. The compound may also display moderate solubility in polar solvents, which is typical for many boronic acids. Additionally, it may participate in reactions such as Suzuki coupling, which is significant in the formation of carbon-carbon bonds in organic synthesis. Overall, the unique structural features of 1,2-dihydro-2-oxopyrimidin-5-yl-5-boronic acid make it a valuable compound in both research and industrial applications.
Formula:C4H5BN2O4
InChI:InChI=1/C4H5BN2O4/c8-3-2(5(10)11)1-6-4(9)7-3/h1,10-11H,(H2,6,7,8,9)
SMILES:c1c(c(nc(n1)O)O)B(O)O
Synonyms:- 2,4-Dihydroxypyrimidine-5-Boronic Acid
- 2,4-Dioxo-1,2,3,4-Tetrahydro-5-Pyrimidinylboronic Acid
- 2,4-Dioxo-1,2,3,4-Tetrahydropyrimidin-5-Ylboronic Acid
- 1,2,3,4-Tetrahydro-2,4-Dioxopyrimidin-5-Yl-5-Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Uracil-5-boronic acid
CAS:Uracil-5-boronic acidFormula:C4H5BN2O4Purity:≥95%Color and Shape: white to off-white solidMolecular weight:155.90g/molUracil-5-boronic acid, 95%
CAS:It finds its application in the probing the interactions between boronic acids and cis-diol-containing biomolecules by affinity capillary electrophoresis. It is also used as an active pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar pr
Formula:C4H5BN2O4Purity:95%Color and Shape:White to pale cream, PowderMolecular weight:155.90



