
CAS 705241-10-7
:1-Ethyl-1H-benzimidazol-4-amine
Description:
1-Ethyl-1H-benzimidazol-4-amine is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an ethyl group attached to the nitrogen atom at the 1-position and an amino group at the 4-position of the benzimidazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or anticancer properties. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. As research continues, the specific applications and mechanisms of action of 1-ethyl-1H-benzimidazol-4-amine may become clearer, contributing to its utility in pharmaceutical formulations.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-2-12-6-11-9-7(10)4-3-5-8(9)12/h3-6H,2,10H2,1H3
InChI key:InChIKey=LTDZWFXBUPOIGU-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=C(N)C=CC2)N=C1
Synonyms:- 1-Ethyl-1H-benzimidazol-4-amine
- 1H-Benzimidazol-4-amine, 1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.