CAS 70526-11-3
:ethyl (2E)-3-pyridin-2-ylprop-2-enoate
Description:
Ethyl (2E)-3-pyridin-2-ylprop-2-enoate, with the CAS number 70526-11-3, is an organic compound characterized by its ester functional group and a pyridine ring. This compound features a prop-2-enoate moiety, indicating it has an alkene structure with a double bond between the second and third carbon atoms of the propyl chain. The presence of the pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, contributes to its unique chemical properties, including potential biological activity and solubility characteristics. Ethyl (2E)-3-pyridin-2-ylprop-2-enoate is likely to exhibit moderate to high polarity due to the ester and nitrogen functionalities, influencing its reactivity and interactions in various chemical environments. It may be used in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules or as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c1-2-13-10(12)7-6-9-5-3-4-8-11-9/h3-8H,2H2,1H3/b7-6+
Synonyms:- 2-propenoic acid, 3-(2-pyridinyl)-, ethyl ester, (2E)-
- Ethyl (2E)-3-(2-pyridinyl)-2-propenoate
- Ethyl (2E)-3-(pyridin-2-yl)acrylate
- Ethyl 3-(2-pyridinyl)acrylate
- Ethyl (E)-3-(2-Pyridyl)acrylate
- Ethyl 3-(2-Pyridinyl)-2(E)-propenoate
- (E)-Ethyl 3-(Pyridin-2-Yl)Acrylate
- (2E)-3-(2-Pyridinyl)-2-propenoic Acid Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(E)-Ethyl 3-(pyridin-2-yl)acrylate
CAS:Formula:C10H11NO2Purity:96%Color and Shape:SolidMolecular weight:177.1998Ethyl (E)-3-(2-pyridinyl)-2-propenoate
CAS:Ethyl (E)-3-(2-pyridinyl)-2-propenoatePurity:≥95%Molecular weight:177.20g/molEthyl (E)-3-(2-Pyridyl)acrylate
CAS:Controlled ProductApplications Ethyl (E)-3-(2-Pyridyl)acrylate (cas# 70526-11-3) is a compound useful in organic synthesis.
Formula:C10H11NO2Color and Shape:NeatMolecular weight:177.20



