CAS 705269-96-1
:3-methyl-1-propyl-1H-pyrazole-4-carboxylic acid
Description:
3-Methyl-1-propyl-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for hydrogen bonding. The presence of a methyl group and a propyl group on the pyrazole ring influences its solubility and reactivity, making it a candidate for various chemical reactions and applications. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as agrochemicals. The molecular structure allows for various interactions, including potential coordination with metal ions, which can be relevant in coordination chemistry. Additionally, the compound's stability, melting point, and solubility in different solvents would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-methyl-1-propyl-1H-pyrazole-4-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C8H12N2O2
InChI:InChI=1/C8H12N2O2/c1-3-4-10-5-7(8(11)12)6(2)9-10/h5H,3-4H2,1-2H3,(H,11,12)
SMILES:CCCn1cc(c(C)n1)C(=O)O
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3-methyl-1-propyl-
- 3-Methyl-1-propyl-1H-pyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
