CAS 705280-65-5
:dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate
Description:
Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two carboxylate ester groups, contributing to its reactivity and potential applications in organic synthesis. The presence of a bromine atom at the 2-position of the imidazole ring enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The dimethyl ester groups provide solubility in organic solvents and can be hydrolyzed to yield carboxylic acids. This compound is of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate is a versatile intermediate in chemical research and development.
Formula:C7H7BrN2O4
InChI:InChI=1/C7H7BrN2O4/c1-13-5(11)3-4(6(12)14-2)10-7(8)9-3/h1-2H3,(H,9,10)
SMILES:COC(=O)c1c(C(=O)OC)[nH]c(Br)n1
Synonyms:- 1H-Imidazole-4,5-dicarboxylic acid, 2-bromo-, dimethyl ester
- Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-4,5-Dicarboxylic Acid, 2-Bromo-, 4,5-Dimethyl Ester
CAS:Formula:C7H7BrN2O4Purity:97%Color and Shape:SolidMolecular weight:263.0455Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate
CAS:<p>Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate</p>Purity:≥95%Color and Shape:SolidMolecular weight:263.05g/molDimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate
CAS:Formula:C7H7BrN2O4Purity:97%Color and Shape:SolidMolecular weight:263.047Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate
CAS:<p>Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate is an alkylating agent that reacts with DNA by the alkylation of guanine. This causes a break in the DNA strands, which leads to cell death. Dimethyl 2-bromo-1H-imidazole-4,5-dicarboxylate is used as a hydrazine precursor in the synthesis of hydrazine and hydrogen peroxide. The oxidized form of this compound is also used as a stabilizer for polyurethane coatings.</p>Formula:C7H7BrN2O4Purity:Min. 95%Molecular weight:263.05 g/mol



