CAS 70551-73-4
:5-(3-chlorophenyl)-3-hydrazino-1,2,4-triazine
Description:
5-(3-Chlorophenyl)-3-hydrazino-1,2,4-triazine is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features a hydrazino group (-NH-NH2) and a 3-chlorophenyl substituent, contributing to its unique chemical properties. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and solubility, often enhancing its biological activity. The hydrazino group may participate in various chemical reactions, including condensation and oxidation, making it a versatile intermediate in organic synthesis. This compound is of interest in medicinal chemistry and agricultural applications, particularly as a potential herbicide or fungicide. Its specific interactions and biological effects would depend on the context of its use, including concentration and environmental conditions. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, warranting further investigation into its potential applications in drug development or agrochemicals.
Formula:C9H8ClN5
InChI:InChI=1/C9H8ClN5/c10-7-3-1-2-6(4-7)8-5-12-15-9(13-8)14-11/h1-5H,11H2,(H,13,14,15)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.