CymitQuimica logo

CAS 70551-74-5

:

5-(3,4-dichlorophenyl)-3-hydrazino-1,2,4-triazine

Description:
5-(3,4-Dichlorophenyl)-3-hydrazino-1,2,4-triazine is a chemical compound characterized by its triazine core, which is a six-membered ring containing three nitrogen atoms. This compound features a hydrazino group (-NH-NH2) at the 3-position and a dichlorophenyl group at the 5-position, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may exhibit significant lipophilicity, which can influence its interaction with biological targets. The hydrazino group can participate in various chemical reactions, including those involving hydrazones and azo compounds. This compound may be of interest in medicinal chemistry, particularly for its potential as an antitumor or antimicrobial agent, although specific biological activities would need to be evaluated through experimental studies. Additionally, its stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and temperature. Overall, 5-(3,4-dichlorophenyl)-3-hydrazino-1,2,4-triazine represents a class of compounds that could be explored for various applications in pharmaceuticals and agrochemicals.
Formula:C9H7Cl2N5
InChI:InChI=1/C9H7Cl2N5/c10-6-2-1-5(3-7(6)11)8-4-13-16-9(14-8)15-12/h1-4H,12H2,(H,14,15,16)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.