CAS 70562-63-9
:6-bromo-1,4-dioxaspiro[4.6]undecane
Description:
6-Bromo-1,4-dioxaspiro[4.6]undecane is a chemical compound characterized by its unique spirocyclic structure, which consists of a dioxane ring fused to a cyclohexane framework. The presence of a bromine atom at the 6-position introduces notable reactivity, making it a potential candidate for various chemical transformations. This compound typically exhibits a moderate level of polarity due to the dioxane moiety, which can influence its solubility in organic solvents. The spiro structure contributes to its rigidity, affecting its conformational properties and potentially its biological activity. As a member of the spiro compound family, it may exhibit interesting pharmacological properties, although specific biological data may vary. The compound's synthesis and reactivity can be explored in the context of organic synthesis, particularly in the development of complex molecules. Safety data should be consulted when handling this compound, as with any brominated organic substance, due to potential hazards associated with bromine.
Formula:C9H15BrO2
InChI:InChI=1/C9H15BrO2/c10-8-4-2-1-3-5-9(8)11-6-7-12-9/h8H,1-7H2
Synonyms:- 6-Bromo-1,4-dioxaspiro[4.6]undecane
- 1,4-Dioxaspiro[4.6]undecane, 6-bromo-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery