CAS 70565-23-0

1-[3-(2,6-dichlorophenyl)-5-methylisoxazol-4-yl]ethanone

Description:

1-[3-(2,6-Dichlorophenyl)-5-methylisoxazol-4-yl]ethanone, with the CAS number 70565-23-0, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its lipophilicity and potential biological activity. The methyl group at the 5-position of the isoxazole enhances its stability and may influence its reactivity. The ethanone functional group suggests that it has ketone characteristics, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features may also influence its solubility, melting point, and reactivity with other chemical species. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₉Cl₂NO₂

InChI: InChI=1/C12H9Cl2NO2/c1-6(16)10-7(2)17-15-12(10)11-8(13)4-3-5-9(11)14/h3-5H,1-2H3

SMILES: CC(=O)c1c(C)onc1c1c(cccc1Cl)Cl

Synonyms:

• 1-[3-(2,6-Dichlorophenyl)-5-Methylisoxazol-4-Yl]Ethan-1-One

1-[3-(2,6-Dichloro-phenyl)-5-methyl-isoxazol-4-yl]-ethanone

CAS: 70565-23-0

Formula: C₁₂H₉Cl₂NO₂

Purity: 95.0%

Molecular weight: 270.11

Ref: 10-F316645