CAS 7057-27-4
:3'-deoxyuridine
Description:
3'-Deoxyuridine, also known by its CAS number 7057-27-4, is a nucleoside analog of uridine, characterized by the absence of a hydroxyl group at the 3' position of the ribose sugar. This structural modification imparts unique biochemical properties, making it significant in various research and therapeutic applications. It is primarily involved in nucleic acid metabolism and can act as an antiviral agent, particularly against certain viruses like herpes simplex virus. 3'-Deoxyuridine is also utilized in studies related to DNA synthesis and repair mechanisms. In terms of solubility, it is generally soluble in water and exhibits stability under physiological conditions, although it may be sensitive to extreme pH levels. The compound can be phosphorylated by cellular kinases to form its active triphosphate form, which can then be incorporated into DNA during replication. Its role in molecular biology and potential therapeutic applications make it a compound of interest in both academic and clinical research settings.
Formula:C9H12N2O5
InChI:InChI=1/C9H12N2O5/c12-4-5-3-6(13)8(16-5)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1
Synonyms:- Uridine, 3'-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3'-Deoxyuridine
CAS:A potential anti-cancer and anti-viral agent
Formula:C9H12N2O5Color and Shape:White to off-white, Powder or crystals or crystalline powderMolecular weight:228.203′-Deoxyuridine
CAS:3′-Deoxyuridine is a potential anticancer and antiviral agent. 3'-deoxyuridine inhibits the production of bovine diarrhoea virus (BVDV) [1].Formula:C9H12N2O5Color and Shape:SolidMolecular weight:228.23'-Deoxyuridine
CAS:3'-Deoxyuridine is a synthetic antibiotic that is used in the treatment of viral infections, such as hepatitis B and C, and HIV. 3'-Deoxyuridine competitively inhibits the synthesis of RNA by binding to the enzyme RNA polymerase. This drug also has antiviral activity against the human cytomegalovirus (CMV) and Hepatitis C virus (HCV). 3'-Deoxyuridine is synthesized from uracil in an organic solvent, trifluoroacetic acid, at low temperatures. The incorporation of deoxynucleoside triphosphates into DNA occurs after cleavage of the terminal phosphate group by water vapor.
Formula:C9H12N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:228.21 g/mol3’-Deoxy Uridine
CAS:Controlled ProductApplications A potential anti-cancer and anti-viral agents.
References Lin, T-S., et al.: J. Med. Chem., 34, 693 (1991),Formula:C9H12N2O5Color and Shape:NeatMolecular weight:228.20







