CAS 7057-33-2
:3′-Deoxycytidine
Description:
3′-Deoxycytidine, also known as dC or deoxycytidine, is a nucleoside that plays a crucial role in the structure of DNA. It consists of a cytosine base attached to a deoxyribose sugar, lacking a hydroxyl group at the 3' position, which distinguishes it from ribonucleosides. This compound is essential for DNA synthesis and repair, as it serves as a building block for DNA strands. 3′-Deoxycytidine is often utilized in molecular biology and biochemistry research, particularly in studies involving DNA replication and repair mechanisms. It can also be phosphorylated to form deoxycytidine triphosphate (dCTP), which is incorporated into DNA during replication. The substance is typically a white to off-white crystalline powder and is soluble in water. Its CAS number, 7057-33-2, is used for identification in chemical databases. As a nucleoside, it is involved in various biochemical pathways and has potential applications in therapeutic contexts, particularly in antiviral and anticancer treatments.
Formula:C9H13N3O4
InChI:InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-6(14)3-5(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m0/s1
InChI key:InChIKey=ZHHOTKZTEUZTHX-SHYZEUOFSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)C1)N2C(=O)N=C(N)C=C2
Synonyms:- 3-Deoxycytidine
- Cytidine, 3′-deoxy-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Amino-1-((2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one
CAS:Formula:C9H13N3O4Purity:98%Color and Shape:SolidMolecular weight:227.21723''-Deoxycytidine
CAS:Formula:C9H13N3O4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:227.223'-Deoxycytidine
CAS:Nucleoside Derivatives - 3’-Deoxy nucleosides; Drugs and Inhibitors; Antiviral agentFormula:C9H13N3O4Color and Shape:SolidMolecular weight:227.223'-Deoxycytidine
CAS:3'-Deoxycytidine is a nucleoside analog used to treat hepatitis. It is an inhibitor of the viral enzyme reverse transcriptase and prevents the synthesis of viral DNA by blocking the formation of low-energy hydrogen bonds between the 3'-hydroxyl group and the 5'-phosphate group of deoxyribonucleotide triphosphates. 3'-Deoxycytidine can be synthesized using solid-phase methods, and has been shown to inhibit human immunodeficiency virus (HIV) in control experiments. This drug also has been shown to have anti-inflammatory effects in experimental bladder inflammation models.Formula:C9H13N3O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:227.22 g/mol3'-Deoxycytidine
CAS:4-Amino-1-((2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-oneFormula:C9H13N3O4Purity:98%Molecular weight:227.22







