CAS 70579-26-9

Porphyra 334

Description:

Porphyra 334, with the CAS number 70579-26-9, is a chemical compound derived from marine algae, specifically red algae of the genus Porphyra. This compound is notable for its role as a natural pigment, primarily functioning as a phycobilin, which contributes to the photosynthetic processes in these algae. Porphyra 334 exhibits strong absorption in the visible light spectrum, particularly in the blue and green regions, making it valuable in various applications, including food coloring and cosmetics. It is also recognized for its antioxidant properties, which can provide health benefits when incorporated into dietary supplements. The compound is generally considered safe for consumption, although its stability can be affected by environmental factors such as light and temperature. As a natural product, Porphyra 334 aligns with the growing trend towards the use of sustainable and eco-friendly ingredients in various industries. Its unique characteristics and potential applications continue to be a subject of research in both food science and biochemistry.

Formula: C₁₄H₂₂N₂O₈

InChI: InChI=1S/C14H22N2O8/c1-7(18)11(13(21)22)16-9-4-14(23,6-17)3-8(12(9)24-2)15-5-10(19)20/h7,11,15,17-18,23H,3-6H2,1-2H3,(H,19,20)(H,21,22)/b16-9+/t7-,11+,14+/m1/s1

InChI key: InChIKey=VIZAVBQHHMQOQF-FCDTZTNESA-N

SMILES: N(\[C@@H]([C@@H](C)O)C(O)=O)=C\1/C(OC)=C(NCC(O)=O)C[C@](CO)(O)C1

Synonyms:

• L-Threonine, N-[(5S)-3-[(carboxymethyl)amino]-5-hydroxy-5-(hydroxymethyl)-2-methoxy-2-cyclohexen-1-ylidene]-, [N(E)]-
• [N(E)]-N-[(5S)-3-[(Carboxymethyl)amino]-5-hydroxy-5-(hydroxymethyl)-2-methoxy-2-cyclohexen-1-ylidene]-L-threonine
• Porphyra 334

Porphyra 334

CAS: 70579-26-9

Porphyra 334 is a mycosporine-like amino acid.

Formula: C₁₄H₂₂N₂O₈

Color and Shape: Solid

Molecular weight: 346.336

Ref: TM-T34113

Porphyra 334

CAS: 70579-26-9

Porphyra 334 is a mycosporine-like amino acid, which is derived from marine red algae, particularly species belonging to the genus Porphyra. This compound is recognized for its photoprotective properties, as it absorbs ultraviolet (UV) radiation effectively. It functions by dissipating harmful UV radiation in the form of heat, thereby minimizing potential damage to cellular structures such as DNA.

Formula: C₁₄H₂₂N₂O₈

Purity: Min. 95%

Molecular weight: 346.33 g/mol

Ref: 3D-XP181825