CAS 70585-52-3
:6-nitroquinoline-8-carboxylic acid
Description:
6-Nitroquinoline-8-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a nitro group at the 6-position and a carboxylic acid group at the 8-position contributes to its chemical reactivity and potential applications. This compound typically exhibits properties such as being a yellow crystalline solid, with moderate solubility in polar solvents due to the carboxylic acid functionality. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-withdrawing nature of the nitro group. Additionally, 6-nitroquinoline-8-carboxylic acid can serve as a precursor or intermediate in the synthesis of other chemical entities, particularly in medicinal chemistry and material science. Its unique structural features may also impart biological activity, making it a subject of interest in pharmacological research. As with many nitro-containing compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C10H6N2O4
InChI:InChI=1/C10H6N2O4/c13-10(14)8-5-7(12(15)16)4-6-2-1-3-11-9(6)8/h1-5H,(H,13,14)
Synonyms:- 6-Nitroquinoline-8-carboxylic acid
- 8-quinolinecarboxylic acid, 6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Nitroquinoline-8-carboxylic acid
CAS:6-Nitroquinoline-8-carboxylic acid
Molecular weight:218.16564g/mol
