CAS 70585-53-4

8-Quinolinecarboxylic acid, 4-methyl-

Description:

8-Quinolinecarboxylic acid, 4-methyl- is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 8-position and a methyl group (-CH3) at the 4-position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and ability to form coordination complexes with metal ions. Its properties may include moderate acidity, and it may participate in hydrogen bonding, influencing its reactivity and interactions with other substances. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₉NO₂

InChI: InChI=1S/C11H9NO2/c1-7-5-6-12-10-8(7)3-2-4-9(10)11(13)14/h2-6H,1H3,(H,13,14)

InChI key: InChIKey=QXIYMAYIEOSSJE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C(C)=CC=N2)C=CC1

4-Methylquinoline-8-carboxylic acid

CAS: 70585-53-4

Versatile small molecule scaffold

Formula: C₁₁H₉NO₂

Purity: Min. 95%

Molecular weight: 187.19 g/mol

Ref: 3D-VCA58553