CymitQuimica logo

CAS 70589-04-7

:

3-(3,5-dimethyl-1H-pyrazol-1-yl)-6-hydrazinopyridazine

Description:
3-(3,5-dimethyl-1H-pyrazol-1-yl)-6-hydrazinopyridazine, identified by its CAS number 70589-04-7, is a chemical compound that features a complex structure incorporating both pyrazole and pyridazine moieties. This compound is characterized by the presence of a hydrazine functional group, which contributes to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in polar solvents, depending on the specific functional groups and their arrangement. The presence of the dimethyl groups on the pyrazole ring can influence the compound's steric and electronic properties, potentially affecting its interactions in biological systems. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Additionally, the hydrazine component may impart specific reactivity, making it of interest in various synthetic pathways. Overall, the characteristics of this compound suggest a versatile role in chemical and biological contexts, warranting further exploration in research and development.
Formula:C9H12N6
InChI:InChI=1/C9H12N6/c1-6-5-7(2)15(14-6)9-4-3-8(11-10)12-13-9/h3-5H,10H2,1-2H3,(H,11,12)
SMILES:Cc1cc(C)n(c2ccc(=NN)[nH]n2)n1
Synonyms:
  • pyridazine, 3-(3,5-dimethyl-1H-pyrazol-1-yl)-6-hydrazinyl-
  • 3-(3,5-Dimethyl-1H-pyrazol-1-yl)-6-hydrazinopyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.