CAS 705941-42-0

[4-(3-methylbenzoyl)piperazin-1-yl]acetic acid

Description:

[4-(3-methylbenzoyl)piperazin-1-yl]acetic acid, with the CAS number 705941-42-0, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-methylbenzoyl group attached to the piperazine, contributing to its aromatic characteristics and potentially influencing its biological activity. The presence of the acetic acid moiety suggests that it can participate in acid-base reactions, and it may exhibit properties typical of both amines and carboxylic acids. The structure indicates potential for hydrogen bonding due to the carboxylic acid group, which may enhance its solubility in polar solvents. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and reactivity would depend on the functional groups present and the overall molecular conformation. As with many piperazine derivatives, it may have applications in drug development, particularly in the fields of neuropharmacology and psychopharmacology.

Formula: C₁₄H₁₈N₂O₃

InChI: InChI=1/C14H18N2O3/c1-11-3-2-4-12(9-11)14(19)16-7-5-15(6-8-16)10-13(17)18/h2-4,9H,5-8,10H2,1H3,(H,17,18)

SMILES: Cc1cccc(c1)C(=O)N1CCN(CC1)CC(=O)O

Synonyms:

• 1-Piperazineacetic acid, 4-(3-methylbenzoyl)-

2-{4-[(3-Methylphenyl)carbonyl]piperazin-1-yl}acetic acid

CAS: 705941-42-0

2-{4-[(3-Methylphenyl)carbonyl]piperazin-1-yl}acetic acid

Molecular weight: 262.30432g/mol

Ref: 54-OR1021196

[4-(3-Methyl-benzoyl)-piperazin-1-yl]-acetic acid

CAS: 705941-42-0

Formula: C₁₄H₁₈N₂O₃

Purity: 98.0%

Molecular weight: 262.309

Ref: 10-F019746