CAS 705944-08-7

2-amino-1-(4-cyclohexylpiperazin-1-yl)ethanone dihydrochloride

Description:

2-amino-1-(4-cyclohexylpiperazin-1-yl)ethanone dihydrochloride is a chemical compound characterized by its structural features, which include an amino group, a ketone functional group, and a piperazine ring substituted with a cyclohexyl group. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water and facilitates its use in biological and pharmaceutical applications. The presence of the piperazine moiety suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of psychoactive agents. The compound's molecular structure contributes to its pharmacological properties, which may include effects on the central nervous system. Additionally, its dihydrochloride form indicates that it can exist as a stable crystalline solid, which is advantageous for formulation and storage. Overall, 2-amino-1-(4-cyclohexylpiperazin-1-yl)ethanone dihydrochloride is a compound of interest in research and development, particularly in the fields of neuropharmacology and drug design.

Formula: C₁₂H₂₅Cl₂N₃O

InChI: InChI=1/C12H23N3O.2ClH/c13-10-12(16)15-8-6-14(7-9-15)11-4-2-1-3-5-11;;/h11H,1-10,13H2;2*1H

SMILES: C1CCC(CC1)N1CCN(CC1)C(=O)CN.Cl.Cl

2-Amino-1-(4-cyclohexylpiperazin-1-yl)ethan-1-one dihydrochloride

CAS: 705944-08-7

2-Amino-1-(4-cyclohexylpiperazin-1-yl)ethan-1-one dihydrochloride

Molecular weight: 298.2524g/mol

Ref: 54-OR1021202

2-Amino-1-(4-cyclohexylpiperazin-1-yl)ethanone

CAS: 705944-08-7

Formula: C₁₂H₂₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.336

Ref: 10-F019794

2-Amino-1-(4-cyclohexyl-piperazin-1-yl)-ethanone dihydrochloride

CAS: 705944-08-7

Purity: 98.0%

Color and Shape: Solid, Crystalline

Molecular weight: 298.25

Ref: 10-F033851