CymitQuimica logo

CAS 70596-02-0

:

ethyl 2-(3-bromo-2-thienyl)-2-oxo-acetate

Description:
Ethyl 2-(3-bromo-2-thienyl)-2-oxo-acetate, identified by its CAS number 70596-02-0, is an organic compound characterized by the presence of a thienyl group, a bromine atom, and an ester functional group. The thienyl moiety contributes to its aromatic properties, while the bromo substituent enhances its reactivity, making it a useful intermediate in organic synthesis. The compound features a carbonyl group (ketone) adjacent to the ester, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Ethyl 2-(3-bromo-2-thienyl)-2-oxo-acetate is typically a solid or liquid at room temperature, depending on its purity and specific formulation. Its applications may include use in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, this compound exemplifies the diverse chemistry associated with thienyl derivatives and their potential utility in various chemical applications.
Formula:C8H7BrO3S
InChI:InChI=1/C8H7BrO3S/c1-2-12-8(11)6(10)7-5(9)3-4-13-7/h3-4H,2H2,1H3
SMILES:CCOC(=O)C(=O)c1c(ccs1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.